C20H14BrN5O3S — CID 137074608
1-(4-bromo-3-methylphenyl)-6-hydroxy-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 137074608) has the molecular formula C20H14BrN5O3S and a molecular weight of 484.34 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-6-hydroxy-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-bromo-3-methylphenyl)-6-hydroxy-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137074608 |
| Molecular Formula | C20H14BrN5O3S |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 483.00 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-6-hydroxy-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | Cc1cc(-n2c(O)c(C=Nc3nnc(-c4ccccc4)s3)c(=O)[nH]c2=O)ccc1Br |
| InChI | InChI=1S/C20H14BrN5O3S/c1-11-9-13(7-8-15(11)21)26-18(28)14(16(27)23-20(26)29)10-22-19-25-24-17(30-19)12-5-3-2-4-6-12/h2-10,28H,1H3,(H,23,27,29) |
| InChIKey | BMTCUQAZZNIOMB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|