C19H14FN5OS — CID 135628467
2-(4-fluorophenyl)-5-methyl-4-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]-1H-pyrazol-3-one (PubChem CID 135628467) has the molecular formula C19H14FN5OS and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-methyl-4-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]-1H-pyrazol-3-one.
| Compound Name | 2-(4-fluorophenyl)-5-methyl-4-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135628467 |
| Molecular Formula | C19H14FN5OS |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-(4-fluorophenyl)-5-methyl-4-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccc(F)cc2)c(=O)c1/C=N/c1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C19H14FN5OS/c1-12-16(18(26)25(24-12)15-9-7-14(20)8-10-15)11-21-19-23-22-17(27-19)13-5-3-2-4-6-13/h2-11,24H,1H3/b21-11+ |
| InChIKey | FHBXZMLRNJWZIA-SRZZPIQSSA-N |
| XLogP | 3.88 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|