C16H13N3S — CID 12690429
(E)-1-(4-methylphenyl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine (PubChem CID 12690429) has the molecular formula C16H13N3S and a molecular weight of 279.37 g/mol. Its IUPAC name is (E)-1-(4-methylphenyl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine.
| Compound Name | (E)-1-(4-methylphenyl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine |
|---|---|
| PubChem CID | 12690429 |
| Molecular Formula | C16H13N3S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (E)-1-(4-methylphenyl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine |
| SMILES | Cc1ccc(/C=N/c2nnc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C16H13N3S/c1-12-7-9-13(10-8-12)11-17-16-19-18-15(20-16)14-5-3-2-4-6-14/h2-11H,1H3/b17-11+ |
| InChIKey | WPWOPDISEAABLN-GZTJUZNOSA-N |
| XLogP | 4.26 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|