C15H9Cl2N3OS — CID 137279187
2,4-dichloro-6-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]phenol (PubChem CID 137279187) has the molecular formula C15H9Cl2N3OS and a molecular weight of 350.23 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 137279187 |
| Molecular Formula | C15H9Cl2N3OS |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 2,4-dichloro-6-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/c1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C15H9Cl2N3OS/c16-11-6-10(13(21)12(17)7-11)8-18-15-20-19-14(22-15)9-4-2-1-3-5-9/h1-8,21H/b18-8+ |
| InChIKey | LPDSDYUNPUPHSV-QGMBQPNBSA-N |
| XLogP | 4.97 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|