C19H15N3O2S — CID 177450648
[2-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]phenyl] 2-methylprop-2-enoate (PubChem CID 177450648) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is [2-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 177450648 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | [2-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccccc1/C=N/c1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C19H15N3O2S/c1-13(2)18(23)24-16-11-7-6-10-15(16)12-20-19-22-21-17(25-19)14-8-4-3-5-9-14/h3-12H,1H2,2H3/b20-12+ |
| InChIKey | KCMGOAWVWHBAFU-UDWIEESQSA-N |
| XLogP | 4.44 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|