C21H14N6O3S — CID 177487794
2-[(4-nitrophenyl)diazenyl]-6-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]phenol (PubChem CID 177487794) has the molecular formula C21H14N6O3S and a molecular weight of 430.45 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)diazenyl]-6-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]phenol.
| Compound Name | 2-[(4-nitrophenyl)diazenyl]-6-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 177487794 |
| Molecular Formula | C21H14N6O3S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2-[(4-nitrophenyl)diazenyl]-6-[(E)-(5-phenyl-1,3,4-thiadiazol-2-yl)iminomethyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2cccc(/C=N/c3nnc(-c4ccccc4)s3)c2O)cc1 |
| InChI | InChI=1S/C21H14N6O3S/c28-19-15(13-22-21-26-25-20(31-21)14-5-2-1-3-6-14)7-4-8-18(19)24-23-16-9-11-17(12-10-16)27(29)30/h1-13,28H/b22-13+,24-23+ |
| InChIKey | BGNFFWYREZEESR-QTANEOQUSA-N |
| XLogP | 5.98 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|