C24H16N8O4S — CID 138374127
(Z)-1-[4-[(5-nitro-1H-indol-3-yl)diazenyl]phenyl]-N-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]ethanimine (PubChem CID 138374127) has the molecular formula C24H16N8O4S and a molecular weight of 512.51 g/mol. Its IUPAC name is (Z)-1-[4-[(5-nitro-1H-indol-3-yl)diazenyl]phenyl]-N-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]ethanimine.
| Compound Name | (Z)-1-[4-[(5-nitro-1H-indol-3-yl)diazenyl]phenyl]-N-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]ethanimine |
|---|---|
| PubChem CID | 138374127 |
| Molecular Formula | C24H16N8O4S |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | (Z)-1-[4-[(5-nitro-1H-indol-3-yl)diazenyl]phenyl]-N-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]ethanimine |
| SMILES | C/C(=N/c1nnc(-c2ccc([N+](=O)[O-])cc2)s1)c1ccc(/N=N/c2c[nH]c3ccc([N+](=O)[O-])cc23)cc1 |
| InChI | InChI=1S/C24H16N8O4S/c1-14(26-24-30-29-23(37-24)16-4-8-18(9-5-16)31(33)34)15-2-6-17(7-3-15)27-28-22-13-25-21-11-10-19(32(35)36)12-20(21)22/h2-13,25H,1H3/b26-14-,28-27+ |
| InChIKey | OJVZTWXHHQWFBU-KCWSSEAOSA-N |
| XLogP | 7.06 |
| TPSA | 164.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|