C18H16ClN3O2S — CID 134121605
2-(4-tert-butylphenyl)-5-(2-chloro-5-nitrophenyl)-1,3,4-thiadiazole (PubChem CID 134121605) has the molecular formula C18H16ClN3O2S and a molecular weight of 373.87 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5-(2-chloro-5-nitrophenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(4-tert-butylphenyl)-5-(2-chloro-5-nitrophenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 134121605 |
| Molecular Formula | C18H16ClN3O2S |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5-(2-chloro-5-nitrophenyl)-1,3,4-thiadiazole |
| SMILES | CC(C)(C)c1ccc(-c2nnc(-c3cc([N+](=O)[O-])ccc3Cl)s2)cc1 |
| InChI | InChI=1S/C18H16ClN3O2S/c1-18(2,3)12-6-4-11(5-7-12)16-20-21-17(25-16)14-10-13(22(23)24)8-9-15(14)19/h4-10H,1-3H3 |
| InChIKey | UHGTXZMYDMMHOB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|