C11H7ClN2O4S — CID 19965126
2-(2-chloro-5-nitrophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 19965126) has the molecular formula C11H7ClN2O4S and a molecular weight of 298.71 g/mol. Its IUPAC name is 2-(2-chloro-5-nitrophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(2-chloro-5-nitrophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19965126 |
| Molecular Formula | C11H7ClN2O4S |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2-(2-chloro-5-nitrophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(-c2cc([N+](=O)[O-])ccc2Cl)sc1C(=O)O |
| InChI | InChI=1S/C11H7ClN2O4S/c1-5-9(11(15)16)19-10(13-5)7-4-6(14(17)18)2-3-8(7)12/h2-4H,1H3,(H,15,16) |
| InChIKey | XUIKHWODHQYBFT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|