C11H6Cl2NO2S- — CID 7745206
2-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 7745206) has the molecular formula C11H6Cl2NO2S- and a molecular weight of 287.15 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | 2-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 7745206 |
| Molecular Formula | C11H6Cl2NO2S- |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 285.95 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccc(Cl)cc2Cl)sc1C(=O)[O-] |
| InChI | InChI=1S/C11H7Cl2NO2S/c1-5-9(11(15)16)17-10(14-5)7-3-2-6(12)4-8(7)13/h2-4H,1H3,(H,15,16)/p-1 |
| InChIKey | ZEQMLJVLQKBPNX-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |