C11H8Cl2N2S2 — CID 82427144
2-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-carbothioamide (PubChem CID 82427144) has the molecular formula C11H8Cl2N2S2 and a molecular weight of 303.24 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-carbothioamide.
| Compound Name | 2-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82427144 |
| Molecular Formula | C11H8Cl2N2S2 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 301.95 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-carbothioamide |
| SMILES | Cc1nc(-c2ccc(Cl)cc2Cl)sc1C(N)=S |
| InChI | InChI=1S/C11H8Cl2N2S2/c1-5-9(10(14)16)17-11(15-5)7-3-2-6(12)4-8(7)13/h2-4H,1H3,(H2,14,16) |
| InChIKey | DOSXJMHQHNTAQY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|