C12H12N2S2 — CID 82425828
4-methyl-2-(4-methylphenyl)-1,3-thiazole-5-carbothioamide (PubChem CID 82425828) has the molecular formula C12H12N2S2 and a molecular weight of 248.38 g/mol. Its IUPAC name is 4-methyl-2-(4-methylphenyl)-1,3-thiazole-5-carbothioamide.
| Compound Name | 4-methyl-2-(4-methylphenyl)-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82425828 |
| Molecular Formula | C12H12N2S2 |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 4-methyl-2-(4-methylphenyl)-1,3-thiazole-5-carbothioamide |
| SMILES | Cc1ccc(-c2nc(C)c(C(N)=S)s2)cc1 |
| InChI | InChI=1S/C12H12N2S2/c1-7-3-5-9(6-4-7)12-14-8(2)10(16-12)11(13)15/h3-6H,1-2H3,(H2,13,15) |
| InChIKey | REOLRUVAUJXYDO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|