C13H14N4S2 — CID 14612310
[(E)-1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethylideneamino]thiourea (PubChem CID 14612310) has the molecular formula C13H14N4S2 and a molecular weight of 290.42 g/mol. Its IUPAC name is [(E)-1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethylideneamino]thiourea.
| Compound Name | [(E)-1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 14612310 |
| Molecular Formula | C13H14N4S2 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | [(E)-1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethylideneamino]thiourea |
| SMILES | C/C(=N\NC(N)=S)c1sc(-c2ccccc2)nc1C |
| InChI | InChI=1S/C13H14N4S2/c1-8-11(9(2)16-17-13(14)18)19-12(15-8)10-6-4-3-5-7-10/h3-7H,1-2H3,(H3,14,17,18)/b16-9+ |
| InChIKey | LIQXXPORQBBPMX-CXUHLZMHSA-N |
| XLogP | 2.68 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|