C7H11N5S2 — CID 676481
[1-(2-amino-4-methyl-1,3-thiazol-5-yl)ethylideneamino]thiourea (PubChem CID 676481) has the molecular formula C7H11N5S2 and a molecular weight of 229.33 g/mol. Its IUPAC name is [1-(2-amino-4-methyl-1,3-thiazol-5-yl)ethylideneamino]thiourea.
| Compound Name | [1-(2-amino-4-methyl-1,3-thiazol-5-yl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 676481 |
| Molecular Formula | C7H11N5S2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | [1-(2-amino-4-methyl-1,3-thiazol-5-yl)ethylideneamino]thiourea |
| SMILES | CC(=NNC(N)=S)c1sc(N)nc1C |
| InChI | InChI=1S/C7H11N5S2/c1-3-5(14-7(9)10-3)4(2)11-12-6(8)13/h1-2H3,(H2,9,10)(H3,8,12,13) |
| InChIKey | QTHCRTXNMOOOJA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|