C19H18N4OS — CID 20997820
2-amino-4-methyl-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]-1,3-thiazole-5-carboxamide (PubChem CID 20997820) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 2-amino-4-methyl-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-4-methyl-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 20997820 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-amino-4-methyl-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]-1,3-thiazole-5-carboxamide |
| SMILES | C/C(=N/NC(=O)c1sc(N)nc1C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N4OS/c1-12(22-23-18(24)17-13(2)21-19(20)25-17)14-8-10-16(11-9-14)15-6-4-3-5-7-15/h3-11H,1-2H3,(H2,20,21)(H,23,24)/b22-12- |
| InChIKey | BHYIBPHTBSNNAN-UUYOSTAYSA-N |
| XLogP | 3.85 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|