C19H16N4O2S — CID 71899021
2-amino-N-(1-benzo[e][1]benzofuran-2-ylethylideneamino)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 71899021) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-amino-N-(1-benzo[e][1]benzofuran-2-ylethylideneamino)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-(1-benzo[e][1]benzofuran-2-ylethylideneamino)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 71899021 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-amino-N-(1-benzo[e][1]benzofuran-2-ylethylideneamino)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CC(=NNC(=O)c1sc(N)nc1C)c1cc2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C19H16N4O2S/c1-10(22-23-18(24)17-11(2)21-19(20)26-17)16-9-14-13-6-4-3-5-12(13)7-8-15(14)25-16/h3-9H,1-2H3,(H2,20,21)(H,23,24) |
| InChIKey | DEWWOAMUVMOYJH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|