C13H13ClN4OS — CID 3145256
2-amino-N-[1-(4-chlorophenyl)ethylideneamino]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 3145256) has the molecular formula C13H13ClN4OS and a molecular weight of 308.79 g/mol. Its IUPAC name is 2-amino-N-[1-(4-chlorophenyl)ethylideneamino]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-[1-(4-chlorophenyl)ethylideneamino]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 3145256 |
| Molecular Formula | C13H13ClN4OS |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-amino-N-[1-(4-chlorophenyl)ethylideneamino]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CC(=NNC(=O)c1sc(N)nc1C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClN4OS/c1-7(9-3-5-10(14)6-4-9)17-18-12(19)11-8(2)16-13(15)20-11/h3-6H,1-2H3,(H2,15,16)(H,18,19) |
| InChIKey | OTEFPCZAWLNTHJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|