C17H15ClN4O — CID 6253210
N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 6253210) has the molecular formula C17H15ClN4O and a molecular weight of 326.79 g/mol. Its IUPAC name is N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6253210 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | C/C(=N\NC(=O)c1c(C)nc2ccccn12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN4O/c1-11(13-6-8-14(18)9-7-13)20-21-17(23)16-12(2)19-15-5-3-4-10-22(15)16/h3-10H,1-2H3,(H,21,23)/b20-11+ |
| InChIKey | AGILTJDRJZNNLR-RGVLZGJSSA-N |
| XLogP | 3.45 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|