C19H19N5O2 — CID 3485132
N-[1-(3-acetamidophenyl)ethylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 3485132) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[1-(3-acetamidophenyl)ethylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[1-(3-acetamidophenyl)ethylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3485132 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[1-(3-acetamidophenyl)ethylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CC(=O)Nc1cccc(C(C)=NNC(=O)c2c(C)nc3ccccn23)c1 |
| InChI | InChI=1S/C19H19N5O2/c1-12(15-7-6-8-16(11-15)21-14(3)25)22-23-19(26)18-13(2)20-17-9-4-5-10-24(17)18/h4-11H,1-3H3,(H,21,25)(H,23,26) |
| InChIKey | NOSPZHBUAPLRFR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|