C17H15N5O3 — CID 6162171
3-methyl-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 6162171) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is 3-methyl-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 3-methyl-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 6162171 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-methyl-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1nc2ccccn2c1C)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15N5O3/c1-11(13-6-5-7-14(10-13)22(24)25)19-20-17(23)16-12(2)21-9-4-3-8-15(21)18-16/h3-10H,1-2H3,(H,20,23)/b19-11- |
| InChIKey | PRYNMGINSHEOBS-ODLFYWEKSA-N |
| XLogP | 2.70 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|