C18H15N5O — CID 3663638
N-[1-(4-cyanophenyl)ethylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 3663638) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)ethylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[1-(4-cyanophenyl)ethylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3663638 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-[1-(4-cyanophenyl)ethylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CC(=NNC(=O)c1c(C)nc2ccccn12)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H15N5O/c1-12(15-8-6-14(11-19)7-9-15)21-22-18(24)17-13(2)20-16-5-3-4-10-23(16)17/h3-10H,1-2H3,(H,22,24) |
| InChIKey | HPRRRTWAAGBYNH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|