C18H23N5OS — CID 71899022
2-amino-4-methyl-N-[1-(4-piperidin-1-ylphenyl)ethylideneamino]-1,3-thiazole-5-carboxamide (PubChem CID 71899022) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-amino-4-methyl-N-[1-(4-piperidin-1-ylphenyl)ethylideneamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-4-methyl-N-[1-(4-piperidin-1-ylphenyl)ethylideneamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 71899022 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-amino-4-methyl-N-[1-(4-piperidin-1-ylphenyl)ethylideneamino]-1,3-thiazole-5-carboxamide |
| SMILES | CC(=NNC(=O)c1sc(N)nc1C)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H23N5OS/c1-12(21-22-17(24)16-13(2)20-18(19)25-16)14-6-8-15(9-7-14)23-10-4-3-5-11-23/h6-9H,3-5,10-11H2,1-2H3,(H2,19,20)(H,22,24) |
| InChIKey | YVTVELWQQMENLC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|