C22H23N5O2S — CID 8984175
3-amino-4,6-dimethyl-N-[(Z)-1-[4-(2-oxopyrrolidin-1-yl)phenyl]ethylideneamino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 8984175) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 3-amino-4,6-dimethyl-N-[(Z)-1-[4-(2-oxopyrrolidin-1-yl)phenyl]ethylideneamino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-4,6-dimethyl-N-[(Z)-1-[4-(2-oxopyrrolidin-1-yl)phenyl]ethylideneamino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 8984175 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-amino-4,6-dimethyl-N-[(Z)-1-[4-(2-oxopyrrolidin-1-yl)phenyl]ethylideneamino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1sc2nc(C)cc(C)c2c1N)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C22H23N5O2S/c1-12-11-13(2)24-22-18(12)19(23)20(30-22)21(29)26-25-14(3)15-6-8-16(9-7-15)27-10-4-5-17(27)28/h6-9,11H,4-5,10,23H2,1-3H3,(H,26,29)/b25-14- |
| InChIKey | PYPBEVXQLWABQO-QFEZKATASA-N |
| XLogP | 3.78 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|