C23H22N4O2S — CID 8862793
3-amino-N-[(Z)-1-[3-(2-oxopyrrolidin-1-yl)phenyl]ethylideneamino]-5-phenylthiophene-2-carboxamide (PubChem CID 8862793) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 3-amino-N-[(Z)-1-[3-(2-oxopyrrolidin-1-yl)phenyl]ethylideneamino]-5-phenylthiophene-2-carboxamide.
| Compound Name | 3-amino-N-[(Z)-1-[3-(2-oxopyrrolidin-1-yl)phenyl]ethylideneamino]-5-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 8862793 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 3-amino-N-[(Z)-1-[3-(2-oxopyrrolidin-1-yl)phenyl]ethylideneamino]-5-phenylthiophene-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1sc(-c2ccccc2)cc1N)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C23H22N4O2S/c1-15(17-9-5-10-18(13-17)27-12-6-11-21(27)28)25-26-23(29)22-19(24)14-20(30-22)16-7-3-2-4-8-16/h2-5,7-10,13-14H,6,11-12,24H2,1H3,(H,26,29)/b25-15- |
| InChIKey | JFGSNCKWLCWMNJ-MYYYXRDXSA-N |
| XLogP | 4.28 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|