C20H26N4O3 — CID 8862777
2-(2-oxoazepan-1-yl)-N-[(Z)-1-[3-(2-oxopyrrolidin-1-yl)phenyl]ethylideneamino]acetamide (PubChem CID 8862777) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(2-oxoazepan-1-yl)-N-[(Z)-1-[3-(2-oxopyrrolidin-1-yl)phenyl]ethylideneamino]acetamide.
| Compound Name | 2-(2-oxoazepan-1-yl)-N-[(Z)-1-[3-(2-oxopyrrolidin-1-yl)phenyl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 8862777 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-(2-oxoazepan-1-yl)-N-[(Z)-1-[3-(2-oxopyrrolidin-1-yl)phenyl]ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CN1CCCCCC1=O)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C20H26N4O3/c1-15(16-7-5-8-17(13-16)24-12-6-10-20(24)27)21-22-18(25)14-23-11-4-2-3-9-19(23)26/h5,7-8,13H,2-4,6,9-12,14H2,1H3,(H,22,25)/b21-15- |
| InChIKey | YQRYJLBDDZZPFU-QNGOZBTKSA-N |
| XLogP | 2.06 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|