C18H22N4O4 — CID 55699414
2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide (PubChem CID 55699414) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55699414 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
| SMILES | CCN1CCN(CC(=O)Nc2cccc(N3CCCC3=O)c2)C(=O)C1=O |
| InChI | InChI=1S/C18H22N4O4/c1-2-20-9-10-21(18(26)17(20)25)12-15(23)19-13-5-3-6-14(11-13)22-8-4-7-16(22)24/h3,5-6,11H,2,4,7-10,12H2,1H3,(H,19,23) |
| InChIKey | MXZXJLLUNKWVRM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|