C20H21N3O3S — CID 36562536
2-(4-acetamidophenyl)sulfanyl-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide (PubChem CID 36562536) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)sulfanyl-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(4-acetamidophenyl)sulfanyl-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 36562536 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-(4-acetamidophenyl)sulfanyl-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SCC(=O)Nc2cccc(N3CCCC3=O)c2)cc1 |
| InChI | InChI=1S/C20H21N3O3S/c1-14(24)21-15-7-9-18(10-8-15)27-13-19(25)22-16-4-2-5-17(12-16)23-11-3-6-20(23)26/h2,4-5,7-10,12H,3,6,11,13H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | QBQKBHPAJPSALC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |