C21H24BrN3O — CID 4301552
N-[1-[4-(azepan-1-yl)phenyl]ethylideneamino]-2-bromobenzamide (PubChem CID 4301552) has the molecular formula C21H24BrN3O and a molecular weight of 414.35 g/mol. Its IUPAC name is N-[1-[4-(azepan-1-yl)phenyl]ethylideneamino]-2-bromobenzamide.
| Compound Name | N-[1-[4-(azepan-1-yl)phenyl]ethylideneamino]-2-bromobenzamide |
|---|---|
| PubChem CID | 4301552 |
| Molecular Formula | C21H24BrN3O |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-[1-[4-(azepan-1-yl)phenyl]ethylideneamino]-2-bromobenzamide |
| SMILES | CC(=NNC(=O)c1ccccc1Br)c1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C21H24BrN3O/c1-16(23-24-21(26)19-8-4-5-9-20(19)22)17-10-12-18(13-11-17)25-14-6-2-3-7-15-25/h4-5,8-13H,2-3,6-7,14-15H2,1H3,(H,24,26) |
| InChIKey | NBZDARQKCAJZGR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|