C16H12BrF3N2O — CID 5050427
2-bromo-N-[1-[3-(trifluoromethyl)phenyl]ethylideneamino]benzamide (PubChem CID 5050427) has the molecular formula C16H12BrF3N2O and a molecular weight of 385.18 g/mol. Its IUPAC name is 2-bromo-N-[1-[3-(trifluoromethyl)phenyl]ethylideneamino]benzamide.
| Compound Name | 2-bromo-N-[1-[3-(trifluoromethyl)phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 5050427 |
| Molecular Formula | C16H12BrF3N2O |
| Molecular Weight | 385.18 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 2-bromo-N-[1-[3-(trifluoromethyl)phenyl]ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccccc1Br)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12BrF3N2O/c1-10(11-5-4-6-12(9-11)16(18,19)20)21-22-15(23)13-7-2-3-8-14(13)17/h2-9H,1H3,(H,22,23) |
| InChIKey | GJVODGCBOYWLKW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|