C15H12F3N3O — CID 4836895
N-[1-[3-(trifluoromethyl)phenyl]ethylideneamino]pyridine-3-carboxamide (PubChem CID 4836895) has the molecular formula C15H12F3N3O and a molecular weight of 307.28 g/mol. Its IUPAC name is N-[1-[3-(trifluoromethyl)phenyl]ethylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[1-[3-(trifluoromethyl)phenyl]ethylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4836895 |
| Molecular Formula | C15H12F3N3O |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-[1-[3-(trifluoromethyl)phenyl]ethylideneamino]pyridine-3-carboxamide |
| SMILES | CC(=NNC(=O)c1cccnc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F3N3O/c1-10(11-4-2-6-13(8-11)15(16,17)18)20-21-14(22)12-5-3-7-19-9-12/h2-9H,1H3,(H,21,22) |
| InChIKey | BNPDHUVQEUOSPT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|