C16H13F3N4O2 — CID 6091313
N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]pyridine-3-carboxamide (PubChem CID 6091313) has the molecular formula C16H13F3N4O2 and a molecular weight of 350.30 g/mol. Its IUPAC name is N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6091313 |
| Molecular Formula | C16H13F3N4O2 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]pyridine-3-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cccnc1)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F3N4O2/c1-10(22-23-14(24)12-3-2-8-20-9-12)11-4-6-13(7-5-11)21-15(25)16(17,18)19/h2-9H,1H3,(H,21,25)(H,23,24)/b22-10- |
| InChIKey | AUBNIWLZRDMFNN-YVNNLAQVSA-N |
| XLogP | 2.74 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|