C21H18ClN5O2 — CID 3265838
N-[1-[4-[(4-chlorophenyl)carbamoylamino]phenyl]ethylideneamino]pyridine-3-carboxamide (PubChem CID 3265838) has the molecular formula C21H18ClN5O2 and a molecular weight of 407.86 g/mol. Its IUPAC name is N-[1-[4-[(4-chlorophenyl)carbamoylamino]phenyl]ethylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[1-[4-[(4-chlorophenyl)carbamoylamino]phenyl]ethylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3265838 |
| Molecular Formula | C21H18ClN5O2 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[1-[4-[(4-chlorophenyl)carbamoylamino]phenyl]ethylideneamino]pyridine-3-carboxamide |
| SMILES | CC(=NNC(=O)c1cccnc1)c1ccc(NC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H18ClN5O2/c1-14(26-27-20(28)16-3-2-12-23-13-16)15-4-8-18(9-5-15)24-21(29)25-19-10-6-17(22)7-11-19/h2-13H,1H3,(H,27,28)(H2,24,25,29) |
| InChIKey | CTJWRFPGAFQGCF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|