C16H13F3N2O2 — CID 6083934
4-[(2Z)-2-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydrazinyl]benzoic acid (PubChem CID 6083934) has the molecular formula C16H13F3N2O2 and a molecular weight of 322.29 g/mol. Its IUPAC name is 4-[(2Z)-2-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[(2Z)-2-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 6083934 |
| Molecular Formula | C16H13F3N2O2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-[(2Z)-2-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydrazinyl]benzoic acid |
| SMILES | C/C(=N/Nc1ccc(C(=O)O)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F3N2O2/c1-10(12-3-2-4-13(9-12)16(17,18)19)20-21-14-7-5-11(6-8-14)15(22)23/h2-9,21H,1H3,(H,22,23)/b20-10- |
| InChIKey | CFSSKXMYOXEMLJ-JMIUGGIZSA-N |
| XLogP | 4.24 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|