C15H11F5N2 — CID 18224635
2,4-difluoro-N-[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]aniline (PubChem CID 18224635) has the molecular formula C15H11F5N2 and a molecular weight of 314.26 g/mol. Its IUPAC name is 2,4-difluoro-N-[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]aniline.
| Compound Name | 2,4-difluoro-N-[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]aniline |
|---|---|
| PubChem CID | 18224635 |
| Molecular Formula | C15H11F5N2 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2,4-difluoro-N-[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]aniline |
| SMILES | C/C(=N\Nc1ccc(F)cc1F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F5N2/c1-9(10-3-2-4-11(7-10)15(18,19)20)21-22-14-6-5-12(16)8-13(14)17/h2-8,22H,1H3/b21-9+ |
| InChIKey | OEFQUMTVKKYCTF-ZVBGSRNCSA-N |
| XLogP | 4.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|