C16H17F2N3 — CID 9058365
N-[(Z)-1-[4-(dimethylamino)phenyl]ethylideneamino]-2,4-difluoroaniline (PubChem CID 9058365) has the molecular formula C16H17F2N3 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[(Z)-1-[4-(dimethylamino)phenyl]ethylideneamino]-2,4-difluoroaniline.
| Compound Name | N-[(Z)-1-[4-(dimethylamino)phenyl]ethylideneamino]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 9058365 |
| Molecular Formula | C16H17F2N3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[(Z)-1-[4-(dimethylamino)phenyl]ethylideneamino]-2,4-difluoroaniline |
| SMILES | C/C(=N/Nc1ccc(F)cc1F)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H17F2N3/c1-11(12-4-7-14(8-5-12)21(2)3)19-20-16-9-6-13(17)10-15(16)18/h4-10,20H,1-3H3/b19-11- |
| InChIKey | SVVFVFBUFRAYMY-ODLFYWEKSA-N |
| XLogP | 3.87 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|