C20H23F2N3O — CID 135588191
4-[(E)-N-(2,4-difluoroanilino)-C-methylcarbonimidoyl]-2-(piperidin-1-ylmethyl)phenol (PubChem CID 135588191) has the molecular formula C20H23F2N3O and a molecular weight of 359.42 g/mol. Its IUPAC name is 4-[(E)-N-(2,4-difluoroanilino)-C-methylcarbonimidoyl]-2-(piperidin-1-ylmethyl)phenol.
| Compound Name | 4-[(E)-N-(2,4-difluoroanilino)-C-methylcarbonimidoyl]-2-(piperidin-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 135588191 |
| Molecular Formula | C20H23F2N3O |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 4-[(E)-N-(2,4-difluoroanilino)-C-methylcarbonimidoyl]-2-(piperidin-1-ylmethyl)phenol |
| SMILES | C/C(=N\Nc1ccc(F)cc1F)c1ccc(O)c(CN2CCCCC2)c1 |
| InChI | InChI=1S/C20H23F2N3O/c1-14(23-24-19-7-6-17(21)12-18(19)22)15-5-8-20(26)16(11-15)13-25-9-3-2-4-10-25/h5-8,11-12,24,26H,2-4,9-10,13H2,1H3/b23-14+ |
| InChIKey | BKTVHPRVEHTKSP-OEAKJJBVSA-N |
| XLogP | 4.49 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|