C21H23F2N3O2 — CID 9058315
2-[4-[(Z)-N-(2,4-difluoroanilino)-C-methylcarbonimidoyl]phenoxy]-1-piperidin-1-ylethanone (PubChem CID 9058315) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is 2-[4-[(Z)-N-(2,4-difluoroanilino)-C-methylcarbonimidoyl]phenoxy]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-[(Z)-N-(2,4-difluoroanilino)-C-methylcarbonimidoyl]phenoxy]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 9058315 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[4-[(Z)-N-(2,4-difluoroanilino)-C-methylcarbonimidoyl]phenoxy]-1-piperidin-1-ylethanone |
| SMILES | C/C(=N/Nc1ccc(F)cc1F)c1ccc(OCC(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H23F2N3O2/c1-15(24-25-20-10-7-17(22)13-19(20)23)16-5-8-18(9-6-16)28-14-21(27)26-11-3-2-4-12-26/h5-10,13,25H,2-4,11-12,14H2,1H3/b24-15- |
| InChIKey | OXQYBNWVMLMXCF-IWIPYMOSSA-N |
| XLogP | 4.19 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|