C21H22FN3O3 — CID 9235557
2-fluoro-N-[(Z)-1-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]ethylideneamino]benzamide (PubChem CID 9235557) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-fluoro-N-[(Z)-1-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]ethylideneamino]benzamide.
| Compound Name | 2-fluoro-N-[(Z)-1-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 9235557 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-fluoro-N-[(Z)-1-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]ethylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccccc1F)c1ccc(OCC(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H22FN3O3/c1-15(23-24-21(27)18-6-2-3-7-19(18)22)16-8-10-17(11-9-16)28-14-20(26)25-12-4-5-13-25/h2-3,6-11H,4-5,12-14H2,1H3,(H,24,27)/b23-15- |
| InChIKey | QBNNFVHTNXSTPT-HAHDFKILSA-N |
| XLogP | 2.98 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|