C19H22F2N2O2 — CID 102417416
4-fluoro-2-[[4-[(5-fluoro-2-hydroxyphenyl)methyl]-1,4-diazepan-1-yl]methyl]phenol (PubChem CID 102417416) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is 4-fluoro-2-[[4-[(5-fluoro-2-hydroxyphenyl)methyl]-1,4-diazepan-1-yl]methyl]phenol.
| Compound Name | 4-fluoro-2-[[4-[(5-fluoro-2-hydroxyphenyl)methyl]-1,4-diazepan-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 102417416 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-fluoro-2-[[4-[(5-fluoro-2-hydroxyphenyl)methyl]-1,4-diazepan-1-yl]methyl]phenol |
| SMILES | Oc1ccc(F)cc1CN1CCCN(Cc2cc(F)ccc2O)CC1 |
| InChI | InChI=1S/C19H22F2N2O2/c20-16-2-4-18(24)14(10-16)12-22-6-1-7-23(9-8-22)13-15-11-17(21)3-5-19(15)25/h2-5,10-11,24-25H,1,6-9,12-13H2 |
| InChIKey | ZZVVFEVUFFOLKT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|