C12H16FNO2 — CID 103947504
4-fluoro-2-[(2-methylmorpholin-4-yl)methyl]phenol (PubChem CID 103947504) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 4-fluoro-2-[(2-methylmorpholin-4-yl)methyl]phenol.
| Compound Name | 4-fluoro-2-[(2-methylmorpholin-4-yl)methyl]phenol |
|---|---|
| PubChem CID | 103947504 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4-fluoro-2-[(2-methylmorpholin-4-yl)methyl]phenol |
| SMILES | CC1CN(Cc2cc(F)ccc2O)CCO1 |
| InChI | InChI=1S/C12H16FNO2/c1-9-7-14(4-5-16-9)8-10-6-11(13)2-3-12(10)15/h2-3,6,9,15H,4-5,7-8H2,1H3 |
| InChIKey | WCYFXCKNUQWBBP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|