C19H22FNO4 — CID 97063266
2-[[(2R)-2-(4-fluorophenyl)morpholin-4-yl]methyl]-4,5-dimethoxyphenol (PubChem CID 97063266) has the molecular formula C19H22FNO4 and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-[[(2R)-2-(4-fluorophenyl)morpholin-4-yl]methyl]-4,5-dimethoxyphenol.
| Compound Name | 2-[[(2R)-2-(4-fluorophenyl)morpholin-4-yl]methyl]-4,5-dimethoxyphenol |
|---|---|
| PubChem CID | 97063266 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[[(2R)-2-(4-fluorophenyl)morpholin-4-yl]methyl]-4,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(CN2CCO[C@H](c3ccc(F)cc3)C2)cc1OC |
| InChI | InChI=1S/C19H22FNO4/c1-23-17-9-14(16(22)10-18(17)24-2)11-21-7-8-25-19(12-21)13-3-5-15(20)6-4-13/h3-6,9-10,19,22H,7-8,11-12H2,1-2H3/t19-/m0/s1 |
| InChIKey | UYSZNKKWKWHEGP-IBGZPJMESA-N |
| XLogP | 3.12 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|