C19H22ClNO3 — CID 77271449
2-(4-chlorophenyl)-4-[(2,4-dimethoxyphenyl)methyl]morpholine (PubChem CID 77271449) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[(2,4-dimethoxyphenyl)methyl]morpholine.
| Compound Name | 2-(4-chlorophenyl)-4-[(2,4-dimethoxyphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 77271449 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[(2,4-dimethoxyphenyl)methyl]morpholine |
| SMILES | COc1ccc(CN2CCOC(c3ccc(Cl)cc3)C2)c(OC)c1 |
| InChI | InChI=1S/C19H22ClNO3/c1-22-17-8-5-15(18(11-17)23-2)12-21-9-10-24-19(13-21)14-3-6-16(20)7-4-14/h3-8,11,19H,9-10,12-13H2,1-2H3 |
| InChIKey | WACFOBVEMPNCEG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |