C26H29NO6S — CID 87367870
[4-[(2S)-4-[(2,4-dimethoxyphenyl)methyl]morpholin-2-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 87367870) has the molecular formula C26H29NO6S and a molecular weight of 483.59 g/mol. Its IUPAC name is [4-[(2S)-4-[(2,4-dimethoxyphenyl)methyl]morpholin-2-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(2S)-4-[(2,4-dimethoxyphenyl)methyl]morpholin-2-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87367870 |
| Molecular Formula | C26H29NO6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | [4-[(2S)-4-[(2,4-dimethoxyphenyl)methyl]morpholin-2-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(CN2CCO[C@@H](c3ccc(OS(=O)(=O)c4ccc(C)cc4)cc3)C2)c(OC)c1 |
| InChI | InChI=1S/C26H29NO6S/c1-19-4-12-24(13-5-19)34(28,29)33-22-9-6-20(7-10-22)26-18-27(14-15-32-26)17-21-8-11-23(30-2)16-25(21)31-3/h4-13,16,26H,14-15,17-18H2,1-3H3/t26-/m1/s1 |
| InChIKey | VSCHHABUMHPUQZ-AREMUKBSSA-N |
| XLogP | 4.35 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|