C24H23NO6S — CID 87366835
phenyl (2S)-2-[4-(4-methylphenyl)sulfonyloxyphenyl]morpholine-4-carboxylate (PubChem CID 87366835) has the molecular formula C24H23NO6S and a molecular weight of 453.52 g/mol. Its IUPAC name is phenyl (2S)-2-[4-(4-methylphenyl)sulfonyloxyphenyl]morpholine-4-carboxylate.
| Compound Name | phenyl (2S)-2-[4-(4-methylphenyl)sulfonyloxyphenyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 87366835 |
| Molecular Formula | C24H23NO6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | phenyl (2S)-2-[4-(4-methylphenyl)sulfonyloxyphenyl]morpholine-4-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc([C@H]3CN(C(=O)Oc4ccccc4)CCO3)cc2)cc1 |
| InChI | InChI=1S/C24H23NO6S/c1-18-7-13-22(14-8-18)32(27,28)31-21-11-9-19(10-12-21)23-17-25(15-16-29-23)24(26)30-20-5-3-2-4-6-20/h2-14,23H,15-17H2,1H3/t23-/m1/s1 |
| InChIKey | VLVNEZMNBIKTNK-HSZRJFAPSA-N |
| XLogP | 4.34 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|