C25H25NO5S — CID 87367719
[4-[(2R)-5-oxo-4-[(1S)-1-phenylethyl]morpholin-2-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 87367719) has the molecular formula C25H25NO5S and a molecular weight of 451.54 g/mol. Its IUPAC name is [4-[(2R)-5-oxo-4-[(1S)-1-phenylethyl]morpholin-2-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(2R)-5-oxo-4-[(1S)-1-phenylethyl]morpholin-2-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87367719 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | [4-[(2R)-5-oxo-4-[(1S)-1-phenylethyl]morpholin-2-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc([C@@H]3CN([C@@H](C)c4ccccc4)C(=O)CO3)cc2)cc1 |
| InChI | InChI=1S/C25H25NO5S/c1-18-8-14-23(15-9-18)32(28,29)31-22-12-10-21(11-13-22)24-16-26(25(27)17-30-24)19(2)20-6-4-3-5-7-20/h3-15,19,24H,16-17H2,1-2H3/t19-,24-/m0/s1 |
| InChIKey | CZUJVILUZOJFAY-CYFREDJKSA-N |
| XLogP | 4.42 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|