C16H16O5S — CID 54756706
[4-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 54756706) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is [4-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54756706 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | [4-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc([C@@H]3O[C@H]3CO)cc2)cc1 |
| InChI | InChI=1S/C16H16O5S/c1-11-2-8-14(9-3-11)22(18,19)21-13-6-4-12(5-7-13)16-15(10-17)20-16/h2-9,15-17H,10H2,1H3/t15-,16-/m0/s1 |
| InChIKey | ACNIXXVPWLIPCP-HOTGVXAUSA-N |
| XLogP | 2.19 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|