C15H17NO7S2 — CID 158855514
N-ethylidenehydroxylamine;4-(4-methylphenyl)sulfonyloxybenzenesulfonic acid (PubChem CID 158855514) has the molecular formula C15H17NO7S2 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-ethylidenehydroxylamine;4-(4-methylphenyl)sulfonyloxybenzenesulfonic acid.
| Compound Name | N-ethylidenehydroxylamine;4-(4-methylphenyl)sulfonyloxybenzenesulfonic acid |
|---|---|
| PubChem CID | 158855514 |
| Molecular Formula | C15H17NO7S2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | N-ethylidenehydroxylamine;4-(4-methylphenyl)sulfonyloxybenzenesulfonic acid |
| SMILES | CC=NO.Cc1ccc(S(=O)(=O)Oc2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C13H12O6S2.C2H5NO/c1-10-2-6-13(7-3-10)21(17,18)19-11-4-8-12(9-5-11)20(14,15)16;1-2-3-4/h2-9H,1H3,(H,14,15,16);2,4H,1H3 |
| InChIKey | IZZPBQMLBJVPOG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|