About S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate
S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate (PubChem CID 154719607) has the molecular formula C18H18O4S2
and a molecular weight of 362.47 g/mol. Its IUPAC name is S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate.
Molecular Properties
| Compound Name | S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate |
| PubChem CID | 154719607 |
| Molecular Formula | C18H18O4S2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate |
| SMILES | CCSC(=O)/C=C/c1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H18O4S2/c1-3-23-18(19)13-8-15-6-9-16(10-7-15)22-24(20,21)17-11-4-14(2)5-12-17/h4-13H,3H2,1-2H3/b13-8+ |
| InChIKey | GOTCVLONLFGWEP-MDWZMJQESA-N |
| XLogP | 4.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate?
The IUPAC name of S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate (CID 154719607) is S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate.
What is the SMILES notation for S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate?
The canonical SMILES for S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate is CCSC(=O)/C=C/c1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate?
The InChIKey is GOTCVLONLFGWEP-MDWZMJQESA-N. The full InChI is InChI=1S/C18H18O4S2/c1-3-23-18(19)13-8-15-6-9-16(10-7-15)22-24(20,21)17-11-4-14(2)5-12-17/h4-13H,3H2,1-2H3/b13-8+.
What are the key properties of S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate?
S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate has a molecular weight of 362.47 g/mol, XLogP of 4.06, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl (E)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]prop-2-enethioate is sourced from PubChem (CID 154719607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).