C25H24O4S — CID 4113859
[4-[3-(4-methylphenyl)-3-oxoprop-1-enyl]phenyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 4113859) has the molecular formula C25H24O4S and a molecular weight of 420.53 g/mol. Its IUPAC name is [4-[3-(4-methylphenyl)-3-oxoprop-1-enyl]phenyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [4-[3-(4-methylphenyl)-3-oxoprop-1-enyl]phenyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 4113859 |
| Molecular Formula | C25H24O4S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [4-[3-(4-methylphenyl)-3-oxoprop-1-enyl]phenyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1ccc(C(=O)C=Cc2ccc(OS(=O)(=O)c3c(C)cc(C)cc3C)cc2)cc1 |
| InChI | InChI=1S/C25H24O4S/c1-17-5-10-22(11-6-17)24(26)14-9-21-7-12-23(13-8-21)29-30(27,28)25-19(3)15-18(2)16-20(25)4/h5-16H,1-4H3 |
| InChIKey | XWJAMQNDCPTXIN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|