C16H16O5S — CID 45464558
4-(2,4,6-trimethylphenyl)sulfonyloxybenzoic acid (PubChem CID 45464558) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is 4-(2,4,6-trimethylphenyl)sulfonyloxybenzoic acid.
| Compound Name | 4-(2,4,6-trimethylphenyl)sulfonyloxybenzoic acid |
|---|---|
| PubChem CID | 45464558 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 4-(2,4,6-trimethylphenyl)sulfonyloxybenzoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2ccc(C(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C16H16O5S/c1-10-8-11(2)15(12(3)9-10)22(19,20)21-14-6-4-13(5-7-14)16(17)18/h4-9H,1-3H3,(H,17,18) |
| InChIKey | LLUCANOTATUNGJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|